(2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid
Modify Date: 2025-08-26 19:46:09
(2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid structure
|
Common Name | (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1984002-08-5 | Molecular Weight | 272.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24N2O4 |
|---|---|
| Molecular Weight | 272.34 |
| InChIKey | RZSULZUHMCLMJB-JTQLQIEISA-N |
| SMILES | CC(C)(C)C(=O)NC(CCN1CCOCC1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid? |
| A: The English name of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid is (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid. |
| Q: What is the CAS number of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid? |
| A: CAS number of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid is 1984002-08-5. |
| Q: What is the molecular weight of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid? |
| A: Molecular weight of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid is 272.34. |
| Q: What is the SMILES notation of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid? |
| A: SMILES notation of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid is CC(C)(C)C(=O)NC(CCN1CCOCC1)C(=O)O. |
| Q: What is the Chinese name of 1984002-08-5? |
| A: Chinese name of 1984002-08-5 is 1984002-08-5. |
| Q: What is the molecular formula of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid? |
| A: Molecular formula of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid is C13H24N2O4. |
| Q: What is the InChIKey of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid? |
| A: InChIKey of (2S)-2-(2,2-Dimethylpropanamido)-4-(morpholin-4-yl)butanoic acid is RZSULZUHMCLMJB-JTQLQIEISA-N. |