7-amino-3,4-dimethyl-1H-quinolin-2-one structure
|
Common Name | 7-amino-3,4-dimethyl-1H-quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 19841-01-1 | Molecular Weight | 188.22600 | |
| Density | 1.173g/cm3 | Boiling Point | 415ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 7-amino-3,4-dimethyl-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 415ºC at 760 mmHg |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.22600 |
| Flash Point | 204.8ºC |
| Exact Mass | 188.09500 |
| PSA | 58.88000 |
| LogP | 2.30830 |
| Vapour Pressure | 4.27E-07mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | SFYRLVFQHRZDCN-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c2ccc(N)cc2[nH]c1=O |
|
~21%
7-amino-3,4-dim... CAS#:19841-01-1 |
| Literature: Chilin; Rodighiero; Pastorini; Guiotto Journal of Organic Chemistry, 1991 , vol. 56, # 3 p. 980 - 983 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3,4-dimethyl-7-aminoquinolin-2-one |