N-[[4-[5-methyl-3-phenylisoxazol-4-yl]phenyl]sulfonyl]acetamide structure
|
Common Name | N-[[4-[5-methyl-3-phenylisoxazol-4-yl]phenyl]sulfonyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 198471-06-6 | Molecular Weight | 356.396 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.396 |
| Exact Mass | 356.083069 |
| PSA | 101.14000 |
| LogP | 1.19 |
| Index of Refraction | 1.587 |
| InChIKey | UMBILIGVYYXBRD-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(-c2c(-c3ccccc3)noc2C)cc1 |
| HS Code | 2934999090 |
|---|
|
~87%
N-[[4-[5-methyl... CAS#:198471-06-6 |
| Literature: Talley, John J.; Bertenshaw, Stephen R.; Brown, David L.; Carter, Jeffery S.; Graneto, Matthew J.; Kellogg, Michael S.; Koboldt, Carol M.; Yuan, Jinhua; Zhang, Yan Y.; Seibert, Karen Journal of Medicinal Chemistry, 2000 , vol. 43, # 9 p. 1661 - 1663 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-{[4-(5-Methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]sulfonyl}acetamide |
| Acetamide, N-[[4-(5-methyl-3-phenyl-4-isoxazolyl)phenyl]sulfonyl]- |
| N-[[4-[5-methyl-3-phenylisoxazol-4-yl]phenyl]sulfonyl]acetamide |
| Parecoxib Impurity 8 |