7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one structure
|
Common Name | 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one | ||
|---|---|---|---|---|
| CAS Number | 1985107-08-1 | Molecular Weight | 246.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2O3 |
|---|---|
| Molecular Weight | 246.26 |
| InChIKey | JPYFWQYIBOOZCO-UHFFFAOYSA-N |
| SMILES | O=C1Nc2c([N+](=O)[O-])cccc2C12CCCCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one? |
| A: InChIKey of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one is JPYFWQYIBOOZCO-UHFFFAOYSA-N. |
| Q: What is the English name of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one? |
| A: The English name of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one is 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one. |
| Q: What is the molecular weight of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one? |
| A: Molecular weight of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one is 246.26. |
| Q: What is the CAS number of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one? |
| A: CAS number of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one is 1985107-08-1. |
| Q: What is the molecular formula of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one? |
| A: Molecular formula of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one is C13H14N2O3. |
| Q: What is the Chinese name of 1985107-08-1? |
| A: Chinese name of 1985107-08-1 is 1985107-08-1. |
| Q: What is the SMILES notation of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one? |
| A: SMILES notation of 7'-Nitrospiro[cyclohexane-1,3'-indolin]-2'-one is O=C1Nc2c([N+](=O)[O-])cccc2C12CCCCC2. |