Fmoc-D-Lys(Mtt)-OH
Fmoc-D-Lys(Mtt)-OH structure
|
Common Name | Fmoc-D-Lys(Mtt)-OH | ||
|---|---|---|---|---|
| CAS Number | 198544-94-4 | Molecular Weight | 624.767 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 798.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C41H40N2O4 | Melting Point | 123-130ºC | |
| MSDS | N/A | Flash Point | 436.9±32.9 °C | |
Summary: N-Fmoc-N’-(4-methyltriphenylmethyl)-D-lysine, also known as Fmoc-D-Lys(Mtt)-OH, has a CAS number of 198544-94-4, with a molecular formula of C41H40N2O4 and a molecular weight of 624.767. This compound is a solid with a melting point of 123-130°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 798.8±60.0 °C at 760 mmHg |
| Melting Point | 123-130ºC |
| Molecular Formula | C41H40N2O4 |
| Molecular Weight | 624.767 |
| Flash Point | 436.9±32.9 °C |
| Exact Mass | 624.298828 |
| PSA | 96.89000 |
| LogP | 9.77 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | YPTNAIDIXCOZAJ-KXQOOQHDSA-N |
| SMILES | Cc1ccc(C(NCCCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| Storage condition | -15°C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[(4-methylphenyl)(diphenyl)methyl]lysine |
| Fmoc-D-Lys(Mtt)-OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: Polar surface area (PSA) of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is 96.89000. |
| Q: What is the boiling point of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: Boiling point of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is 798.8±60.0 °C at 760 mmHg. |
| Q: What is the InChIKey of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: InChIKey of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is YPTNAIDIXCOZAJ-KXQOOQHDSA-N. |
| Q: What is the molecular weight of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: Molecular weight of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is 624.767. |
| Q: What English synonyms does (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid have? |
| A: English synonyms of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-[(4-methylphenyl)(diphenyl)methyl]lysine, Fmoc-D-Lys(Mtt)-OH. |
| Q: What is the CAS number of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: CAS number of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is 198544-94-4. |
| Q: What is the physical appearance of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid appears as Solid. |
| Q: What is the SMILES notation of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: SMILES notation of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is Cc1ccc(C(NCCCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1. |
| Q: What is the molecular formula of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: Molecular formula of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is C41H40N2O4. |
| Q: What is the LogP of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid? |
| A: LogP of (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid is 9.77. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |