baloxavir marboxil structure
|
Common Name | baloxavir marboxil | ||
|---|---|---|---|---|
| CAS Number | 1985606-14-1 | Molecular Weight | 571.549 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 712.8±70.0 °C at 760 mmHg | |
| Molecular Formula | C27H23F2N3O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.9±35.7 °C | |
Use of baloxavir marboxilBaloxavir marboxil is a prodrug of S-033447. S-033447 is a small molecule inhibitor of the cap-dependent endonuclease of influenza A and B viruses. |
| Name | Baloxavir marboxil |
|---|---|
| Synonym | More Synonyms |
| Description | Baloxavir marboxil is a prodrug of S-033447. S-033447 is a small molecule inhibitor of the cap-dependent endonuclease of influenza A and B viruses. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 712.8±70.0 °C at 760 mmHg |
| Molecular Formula | C27H23F2N3O7S |
| Molecular Weight | 571.549 |
| Flash Point | 384.9±35.7 °C |
| Exact Mass | 571.122498 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | RZVPBGBYGMDSBG-GGAORHGYSA-N |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N(C1c3ccccc3SCc3c1ccc(F)c3F)C1COCCN1C2=O |
| Storage condition | 2-8℃ |
| baloxavir marboxil |
| 10491 |
| 505CXM6OHG |
| ({(12aR)-12-[(11S)-7,8-Difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-yl]-6,8-dioxo-3,4,6,8,12,12a-hexahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazin-7-yl}oxy)methyl methyl carbonate |
| Carbonic acid, [[(12aR)-12-[(11S)-7,8-difluoro-6,11-dihydrodibenzo[b,e]thiepin-11-yl]-3,4,6,8,12,12a-hexahydro-6,8-dioxo-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazin-7-yl]oxy]methyl methyl ester |