tert-butyl 4-(2-hydroxyethylidene)piperidine-1-carboxylate
Modify Date: 2024-02-04 15:06:14
tert-butyl 4-(2-hydroxyethylidene)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(2-hydroxyethylidene)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 198892-80-7 | Molecular Weight | 227.30000 | |
| Density | 1.14g/cm3 | Boiling Point | 334.427ºC at 760 mmHg | |
| Molecular Formula | C12H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.056ºC | |
| Name | tert-butyl 4-(2-hydroxyethylidene)piperidine-1-carboxylate |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 334.427ºC at 760 mmHg |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30000 |
| Flash Point | 156.056ºC |
| Exact Mass | 227.15200 |
| PSA | 49.77000 |
| LogP | 1.87390 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | ZNAVZFXRZLNPFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CCO)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |