9-[(Z)-2-nitropent-1-enyl]phenanthrene structure
|
Common Name | 9-[(Z)-2-nitropent-1-enyl]phenanthrene | ||
|---|---|---|---|---|
| CAS Number | 19893-69-7 | Molecular Weight | 291.34400 | |
| Density | 1.192g/cm3 | Boiling Point | 483.6ºC at 760 mmHg | |
| Molecular Formula | C19H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
| Name | 9-[(Z)-2-nitropent-1-enyl]phenanthrene |
|---|
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760 mmHg |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.34400 |
| Flash Point | 227.4ºC |
| Exact Mass | 291.12600 |
| PSA | 45.82000 |
| LogP | 5.93390 |
| Vapour Pressure | 4.87E-09mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | PLYWTECLVZAULC-SSZFMOIBSA-N |
| SMILES | CCCC(=Cc1cc2ccccc2c2ccccc12)[N+](=O)[O-] |
|
~%
9-[(Z)-2-nitrop... CAS#:19893-69-7 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1969 , vol. 12, # 1 p. 157 - 161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |