Tryptophan, N-acetyl-, p-nitrophenyl ester, DL structure
|
Common Name | Tryptophan, N-acetyl-, p-nitrophenyl ester, DL | ||
|---|---|---|---|---|
| CAS Number | 1990-34-7 | Molecular Weight | 367.35500 | |
| Density | 1.371g/cm3 | Boiling Point | 687.3ºC at 760 mmHg | |
| Molecular Formula | C19H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.5ºC | |
| Name | (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 687.3ºC at 760 mmHg |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.35500 |
| Flash Point | 369.5ºC |
| Exact Mass | 367.11700 |
| PSA | 117.01000 |
| LogP | 3.64300 |
| Vapour Pressure | 9.61E-19mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | QCLCPFXPLVJTLB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|
~64%
Tryptophan, N-a... CAS#:1990-34-7 |
| Literature: Ekkati, Anil R.; Kodanko, Jeremy J. Journal of the American Chemical Society, 2007 , vol. 129, # 41 p. 12390 - 12391 |
|
~%
Tryptophan, N-a... CAS#:1990-34-7 |
| Literature: Vyprachticky, Drahomir; Pokorna, Veronika; Pecka, Jan; Mikes, Frantisek Collection of Czechoslovak Chemical Communications, 1999 , vol. 64, # 9 p. 1369 - 1384 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Acetyl-tryptophan-p-nitrophenylester |
| N-Acetyl-DL-tryptophane 4-nitrophenyl ester |