Tryptophan, N-acetyl-, p-nitrophenyl ester, DL
Tryptophan, N-acetyl-, p-nitrophenyl ester, DL structure
|
Common Name | Tryptophan, N-acetyl-, p-nitrophenyl ester, DL | ||
|---|---|---|---|---|
| CAS Number | 1990-34-7 | Molecular Weight | 367.35500 | |
| Density | 1.371g/cm3 | Boiling Point | 687.3ºC at 760 mmHg | |
| Molecular Formula | C19H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 687.3ºC at 760 mmHg |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.35500 |
| Flash Point | 369.5ºC |
| Exact Mass | 367.11700 |
| PSA | 117.01000 |
| LogP | 3.64300 |
| Vapour Pressure | 9.61E-19mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | QCLCPFXPLVJTLB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~64%
Tryptophan, N-a... CAS#:1990-34-7 |
| Literature: Ekkati, Anil R.; Kodanko, Jeremy J. Journal of the American Chemical Society, 2007 , vol. 129, # 41 p. 12390 - 12391 |
|
~%
Tryptophan, N-a... CAS#:1990-34-7 |
| Literature: Vyprachticky, Drahomir; Pokorna, Veronika; Pecka, Jan; Mikes, Frantisek Collection of Czechoslovak Chemical Communications, 1999 , vol. 64, # 9 p. 1369 - 1384 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Acetyl-tryptophan-p-nitrophenylester |
| N-Acetyl-DL-tryptophane 4-nitrophenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: Molecular weight of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is 367.35500. |
| Q: What is the polar surface area (PSA) of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: Polar surface area (PSA) of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is 117.01000. |
| Q: What is the English name of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: The English name of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate. |
| Q: What English synonyms does (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate have? |
| A: English synonyms of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate: N-Acetyl-tryptophan-p-nitrophenylester, N-Acetyl-DL-tryptophane 4-nitrophenyl ester. |
| Q: What is the InChIKey of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: InChIKey of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is QCLCPFXPLVJTLB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: SMILES notation of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)Oc1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: Molecular formula of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is C19H17N3O5. |
| Q: What is the boiling point of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: Boiling point of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is 687.3ºC at 760 mmHg. |
| Q: What is the LogP of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: LogP of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is 3.64300. |
| Q: What is the CAS number of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate? |
| A: CAS number of (4-nitrophenyl) 2-acetamido-3-(1H-indol-3-yl)propanoate is 1990-34-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |