Bakkenolide A structure
|
Common Name | Bakkenolide A | ||
|---|---|---|---|---|
| CAS Number | 19906-72-0 | Molecular Weight | 234.334 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 360.7±31.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | 80-81 °C | |
| MSDS | N/A | Flash Point | 150.7±22.2 °C | |
Use of Bakkenolide ABakkenolide A is a natural product extracted from Petasites tricholobus. Bakkenolide A inhibits leukemia by regulation of HDAC3 and PI3K/Akt-related signaling pathways[1]. |
| Name | (2R,3aR,7S,7aR)-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-2'-one |
|---|---|
| Synonym | More Synonyms |
| Description | Bakkenolide A is a natural product extracted from Petasites tricholobus. Bakkenolide A inhibits leukemia by regulation of HDAC3 and PI3K/Akt-related signaling pathways[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.7±31.0 °C at 760 mmHg |
| Melting Point | 80-81 °C |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.334 |
| Flash Point | 150.7±22.2 °C |
| Exact Mass | 234.161987 |
| PSA | 26.30000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | OVXAYHNZXBOVPV-QMGNLALYSA-N |
| SMILES | C=C1COC(=O)C12CC1CCCC(C)C1(C)C2 |
| Bakkenolide A |
| Spiro[furan-3(2H),2'-[2H]inden]-2-one, decahydro-3'a,4'-dimethyl-4-methylene-, (3R,3a'R,4'S,7a'R)- |
| Fukinanolid |
| Bakkenolid A |
| (3R,3a'R,4'S,7a'R)-3a',4'-Dimethyl-4-methylenedecahydrospiro[furan-3,2'-inden]-2-one |
| FUKINANOLIDE |