propan-2-yl 2-(4-formylphenoxy)acetate structure
|
Common Name | propan-2-yl 2-(4-formylphenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 199177-25-8 | Molecular Weight | 222.23700 | |
| Density | 1.14g/cm3 | Boiling Point | 335.881ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.487ºC | |
| Name | propan-2-yl 2-(4-formylphenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 335.881ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 147.487ºC |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.82950 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | SIPMCPQKUMPVBW-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)COc1ccc(C=O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ISOPROPYL (4-FORMYLPHENOXY)ACETATE |
| Acetic acid,(4-formylphenoxy)-,1-methylethyl ester |