{[(3S)-4-(Benzyloxy)-2,3-dimethyl-2-butanyl]oxy}(dimethyl)(2-meth yl-2-propanyl)silane structure
|
Common Name | {[(3S)-4-(Benzyloxy)-2,3-dimethyl-2-butanyl]oxy}(dimethyl)(2-meth yl-2-propanyl)silane | ||
|---|---|---|---|---|
| CAS Number | 199191-11-2 | Molecular Weight | 322.55800 | |
| Density | 0.914g/cm3 | Boiling Point | 356.039ºC at 760 mmHg | |
| Molecular Formula | C19H34O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.711ºC | |
| Name | {[(3S)-4-(Benzyloxy)-2,3-dimethyl-2-butanyl]oxy}(dimethyl)(2-meth yl-2-propanyl)silane |
|---|
| Density | 0.914g/cm3 |
|---|---|
| Boiling Point | 356.039ºC at 760 mmHg |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.55800 |
| Flash Point | 141.711ºC |
| Exact Mass | 322.23300 |
| PSA | 18.46000 |
| LogP | 5.63970 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | OKDNUJKBPDXEMV-INIZCTEOSA-N |
| SMILES | CC(COCc1ccccc1)C(C)(C)O[Si](C)(C)C(C)(C)C |
|
~89%
{[(3S)-4-(Benzy... CAS#:199191-11-2 |
| Literature: Ihara, Masataka; Tanaka, Yuko; Takahashi, Nobuyuki; Tokunaga, Yuji; Fukumoto, Keiichiro Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 20 p. 3043 - 3052 |
|
~%
{[(3S)-4-(Benzy... CAS#:199191-11-2 |
| Literature: Ihara, Masataka; Tanaka, Yuko; Takahashi, Nobuyuki; Tokunaga, Yuji; Fukumoto, Keiichiro Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 20 p. 3043 - 3052 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |