1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione
Modify Date: 2025-09-13 17:15:23
1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione structure
|
Common Name | 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione | ||
|---|---|---|---|---|
| CAS Number | 199191-75-8 | Molecular Weight | 422.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9F14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9F14O3 |
|---|---|
| Molecular Weight | 422.07 |
| InChIKey | HFLPVEAQVCJZMU-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)C(F)(C(F)(F)F)C(F)(F)F)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione? |
| A: InChIKey of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione is HFLPVEAQVCJZMU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione? |
| A: CAS number of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione is 199191-75-8. |
| Q: What is the Chinese name of 199191-75-8? |
| A: Chinese name of 199191-75-8 is 199191-75-8. |
| Q: What is the molecular weight of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione? |
| A: Molecular weight of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione is 422.07. |
| Q: What is the SMILES notation of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione? |
| A: SMILES notation of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione is O=C(C(=O)C(F)(C(F)(F)F)C(F)(F)F)C(=O)C(F)(C(F)(F)F)C(F)(F)F. |
| Q: What is the English name of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione? |
| A: The English name of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione is 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione. |
| Q: What is the molecular formula of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione? |
| A: Molecular formula of 1,1,1,2,6,7,7,7-Octafluoro-2,6-bis(trifluoromethyl)heptane-3,4,5-trione is C9F14O3. |