2-(4-amino-3-methoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol structure
|
Common Name | 2-(4-amino-3-methoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1992-01-4 | Molecular Weight | 289.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-amino-3-methoxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|
| Molecular Formula | C10H9F6NO2 |
|---|---|
| Molecular Weight | 289.17400 |
| Exact Mass | 289.05400 |
| PSA | 55.48000 |
| LogP | 3.17080 |
| InChIKey | JNOIGSSVGODOOZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N |
| HS Code | 2922509090 |
|---|
|
~41%
2-(4-amino-3-me... CAS#:1992-01-4 |
| Literature: Aoyama, Atsushi; Aoyama, Hiroshi; Makishima, Makoto; Hashimoto, Yuichi; Miyachi, Hiroyuki Heterocycles, 2009 , vol. 78, # 9 p. 2209 - 2216 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |