(3-nitrophenyl) 2-chloroacetate structure
|
Common Name | (3-nitrophenyl) 2-chloroacetate | ||
|---|---|---|---|---|
| CAS Number | 19921-01-8 | Molecular Weight | 215.59100 | |
| Density | 1.434g/cm3 | Boiling Point | 318ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.1ºC | |
| Name | (3-nitrophenyl) 2-chloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 318ºC at 760 mmHg |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.59100 |
| Flash Point | 146.1ºC |
| Exact Mass | 214.99900 |
| PSA | 72.12000 |
| LogP | 2.26220 |
| Vapour Pressure | 0.000371mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | FCBCGSWCYFFYFD-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Oc1cccc([N+](=O)[O-])c1 |
|
~%
(3-nitrophenyl)... CAS#:19921-01-8 |
| Literature: Szell et al. Journal of Scientific and Industrial Research, 1959 , vol. 18 B, p. 325 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| m-Nitrophenylchloracetat |
| 3-nitrophenyl chloroacetate |
| Chlor-essigsaeure-(3-nitro-phenylester) |
| chloro-acetic acid-(3-nitro-phenyl ester) |
| <3-Nitro-phenyl>-chloracetat |