2-[[10-[[bis(2-hydroxyethyl)amino]methyl]anthracen-9-yl]methyl-(2-hydroxyethyl)amino]ethanol structure
|
Common Name | 2-[[10-[[bis(2-hydroxyethyl)amino]methyl]anthracen-9-yl]methyl-(2-hydroxyethyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 19926-08-0 | Molecular Weight | 412.52200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[10-[[bis(2-hydroxyethyl)amino]methyl]anthracen-9-yl]methyl-(2-hydroxyethyl)amino]ethanol |
|---|
| Molecular Formula | C24H32N2O4 |
|---|---|
| Molecular Weight | 412.52200 |
| Exact Mass | 412.23600 |
| PSA | 87.40000 |
| LogP | 1.56620 |
| InChIKey | YJMAXCRSVMVTMW-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)Cc1c2ccccc2c(CN(CCO)CCO)c2ccccc12 |
|
~40%
2-[[10-[[bis(2-... CAS#:19926-08-0 |
| Literature: Bissell, Richard A.; Calle, Emilio; Silva, A. Prasanna de; Silva, Saliya A. de; Gunaratne, H. Q. Nimal; et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 9 p. 1559 - 1564 |
|
~63%
2-[[10-[[bis(2-... CAS#:19926-08-0 |
| Literature: Tan, Willy B.; Bhambhani, Akhilesh; Duff, Michael R.; Rodger, Alison; Kumar, Challa V. Photochemistry and Photobiology, 2006 , vol. 82, # 1 p. 20 - 30 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |