TERT-BUTYL(5-FORMYLPYRIDIN-2-YL)CARBAMATE
TERT-BUTYL(5-FORMYLPYRIDIN-2-YL)CARBAMATE structure
|
Common Name | TERT-BUTYL(5-FORMYLPYRIDIN-2-YL)CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 199296-40-7 | Molecular Weight | 222.240 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 316.3±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.1±23.7 °C | |
Summary: 2-(Boc-aminopyrid-5-yl)formaldehyde, also known as tert-butyl N-(5-formylpyridin-2-yl)carbamate, CAS number 199296-40-7, has a molecular formula of C11H14N2O3 and a molecular weight of 222.240. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(5-formylpyridin-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 316.3±27.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.240 |
| Flash Point | 145.1±23.7 °C |
| Exact Mass | 222.100449 |
| PSA | 68.29000 |
| LogP | 1.99 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | WZROBBWIJBBWQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C=O)cn1 |
| Water Solubility | Soluble in water. |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
TERT-BUTYL(5-FO... CAS#:199296-40-7 |
| Literature: SANOFI; BOEHM, Claudius; KLEIN, Susanne; NAPIERSKI, Bernard; SOMMER, Christian Patent: US2013/245274 A1, 2013 ; Location in patent: Paragraph 0283; 0284 ; |
|
~%
TERT-BUTYL(5-FO... CAS#:199296-40-7 |
| Literature: US5866573 A1, ; US 5866573 A |
|
~%
TERT-BUTYL(5-FO... CAS#:199296-40-7 |
| Literature: EP2216330 A1, ; Page/Page column 24 ; EP 2216330 A1 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl 5-formylpyridin-2-ylcarbamate |
| MFCD08064228 |
| 2-Methyl-2-propanyl (5-formyl-2-pyridinyl)carbamate |
| Carbamic acid, N-(5-formyl-2-pyridinyl)-, 1,1-dimethylethyl ester |
| TERT-BUTYL (5-FORMYLPYRIDIN-2-YL)CARBAMATE |
| 2-(3-ETHOXY-PHENYL)-ACETAMIDINE |
| (5-formyl-pyridin-2-yl)-carbamic acid tert-butyl ester |
| TERT-BUTYL(5-FORMYLPYRIDIN-2-YL)CARBAMATE |
| 2-(t-butoxycarbonylamino)-5-pyridinecarboxaldehyde |
| 2-(Bocamino)-5-pyridinecarboxaldehyde |
| 2-Methyl-2-propanyl(5-formyl-2-pyridinyl)carbamate |
| 2-(Boc-amino)pyridine-5-carboxaldehyde |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: The English name of tert-butyl N-(5-formylpyridin-2-yl)carbamate is tert-butyl N-(5-formylpyridin-2-yl)carbamate. |
| Q: How is the water solubility of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: Water solubility of tert-butyl N-(5-formylpyridin-2-yl)carbamate: Soluble in water. |
| Q: What is the polar surface area (PSA) of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-(5-formylpyridin-2-yl)carbamate is 68.29000. |
| Q: What is the SMILES notation of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: SMILES notation of tert-butyl N-(5-formylpyridin-2-yl)carbamate is CC(C)(C)OC(=O)Nc1ccc(C=O)cn1. |
| Q: What is the CAS number of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: CAS number of tert-butyl N-(5-formylpyridin-2-yl)carbamate is 199296-40-7. |
| Q: What is the molecular weight of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: Molecular weight of tert-butyl N-(5-formylpyridin-2-yl)carbamate is 222.240. |
| Q: What is the LogP of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: LogP of tert-butyl N-(5-formylpyridin-2-yl)carbamate is 1.99. |
| Q: What is the molecular formula of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: Molecular formula of tert-butyl N-(5-formylpyridin-2-yl)carbamate is C11H14N2O3. |
| Q: What is the boiling point of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: Boiling point of tert-butyl N-(5-formylpyridin-2-yl)carbamate is 316.3±27.0 °C at 760 mmHg. |
| Q: What is the InChIKey of tert-butyl N-(5-formylpyridin-2-yl)carbamate? |
| A: InChIKey of tert-butyl N-(5-formylpyridin-2-yl)carbamate is WZROBBWIJBBWQP-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |