1-Naphthyl b-D-glucopyranoside structure
|
Common Name | 1-Naphthyl b-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 19939-82-3 | Molecular Weight | 306.31100 | |
| Density | 1.454g/cm3 | Boiling Point | 567.9ºC at 760mmHg | |
| Molecular Formula | C16H18O6 | Melting Point | 182ºC | |
| MSDS | N/A | Flash Point | 297.3ºC | |
| Name | 1-NAPHTHYL-β-D-GLUCOPYRANOSIDE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 567.9ºC at 760mmHg |
| Melting Point | 182ºC |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31100 |
| Flash Point | 297.3ºC |
| Exact Mass | 306.11000 |
| PSA | 99.38000 |
| LogP | 0.01850 |
| Vapour Pressure | 9.78E-14mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | CVAOQMBKGUKOIZ-IBEHDNSVSA-N |
| SMILES | OCC1OC(Oc2cccc3ccccc23)C(O)C(O)C1O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Naphthyl b-D-glucopyranoside |