3-(Pentafluorophenyl)propanamide structure
|
Common Name | 3-(Pentafluorophenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 1994-24-7 | Molecular Weight | 239.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(Pentafluorophenyl)propanamide |
|---|
| Molecular Formula | C9H6F5NO |
|---|---|
| Molecular Weight | 239.14200 |
| Exact Mass | 239.03700 |
| PSA | 44.08000 |
| LogP | 2.94970 |
| InChIKey | SQAOPJSPFRAAKB-UHFFFAOYSA-N |
| SMILES | NC(=O)CCc1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2924299090 |
|---|
|
~52%
3-(Pentafluorop... CAS#:1994-24-7 |
| Literature: Sun, Zhong-Ming; Zhang, Jing; Manan, Rajith S.; Zhao, Pinjing Journal of the American Chemical Society, 2010 , vol. 132, # 20 p. 6935 - 6937 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |