N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide
Modify Date: 2025-09-09 22:58:35
![N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide Structure](https://www.chemsrc.com/extcaspic/394/1994053-25-6.png)
N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide structure
|
Common Name | N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide | ||
|---|---|---|---|---|
| CAS Number | 1994053-25-6 | Molecular Weight | 219.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO3 |
|---|---|
| Molecular Weight | 219.24 |
| InChIKey | ODXTWHPVIXZHFD-UHFFFAOYSA-N |
| SMILES | C#CC(=O)NCc1ccc(OC)c(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide? |
| A: InChIKey of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide is ODXTWHPVIXZHFD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1994053-25-6? |
| A: Chinese name of 1994053-25-6 is 1994053-25-6. |
| Q: What is the molecular formula of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide? |
| A: Molecular formula of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide is C12H13NO3. |
| Q: What is the English name of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide? |
| A: The English name of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide is N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide. |
| Q: What is the SMILES notation of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide? |
| A: SMILES notation of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide is C#CC(=O)NCc1ccc(OC)c(OC)c1. |
| Q: What is the molecular weight of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide? |
| A: Molecular weight of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide is 219.24. |
| Q: What is the CAS number of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide? |
| A: CAS number of N-[(3,4-dimethoxyphenyl)methyl]prop-2-ynamide is 1994053-25-6. |