2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride
Modify Date: 2025-09-23 18:17:28
![2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride Structure](https://www.chemsrc.com/extcaspic/486/199461-29-5.png)
2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride structure
|
Common Name | 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 199461-29-5 | Molecular Weight | 297.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9ClFN3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9ClFN3O2S2 |
|---|---|
| Molecular Weight | 297.8 |
| InChIKey | ZZFCUUOCCWRYIG-YGCVIUNWSA-N |
| SMILES | Cl.Cn1c(=NN)sc2ccc(S(=O)(=O)F)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride? |
| A: SMILES notation of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride is Cl.Cn1c(=NN)sc2ccc(S(=O)(=O)F)cc21. |
| Q: What is the molecular formula of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride? |
| A: Molecular formula of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride is C8H9ClFN3O2S2. |
| Q: What is the Chinese name of 199461-29-5? |
| A: Chinese name of 199461-29-5 is 199461-29-5. |
| Q: What is the English name of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride? |
| A: The English name of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride is 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride. |
| Q: What is the CAS number of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride? |
| A: CAS number of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride is 199461-29-5. |
| Q: What is the InChIKey of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride? |
| A: InChIKey of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride is ZZFCUUOCCWRYIG-YGCVIUNWSA-N. |
| Q: What is the molecular weight of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride? |
| A: Molecular weight of 2-Hydrazono-3-methyl-2,3-dihydrobenzo[d]thiazole-5-sulfonyl fluoride hydrochloride is 297.8. |