3-Chloro-N-(4-Methoxybenzyl)-4-Methylaniline structure
|
Common Name | 3-Chloro-N-(4-Methoxybenzyl)-4-Methylaniline | ||
|---|---|---|---|---|
| CAS Number | 199481-04-4 | Molecular Weight | 261.74700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(p-methoxybenzyl)-3-chloro-4-methyl aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16ClNO |
|---|---|
| Molecular Weight | 261.74700 |
| Exact Mass | 261.09200 |
| PSA | 21.26000 |
| LogP | 4.34210 |
| InChIKey | XAFILIFHPMJQAM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNc2ccc(C)c(Cl)c2)cc1 |
|
~%
3-Chloro-N-(4-M... CAS#:199481-04-4 |
| Literature: Hennessy, Edward J.; Buchwald, Stephen L. Journal of the American Chemical Society, 2003 , vol. 125, # 40 p. 12084 - 12085 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Chloro-N-(4-methoxybenzyl)-4-methylaniline |