12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane
Modify Date: 2026-06-30 18:38:45
12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane structure
|
Common Name | 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane | ||
|---|---|---|---|---|
| CAS Number | 199484-67-8 | Molecular Weight | 327.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27BrO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H27BrO3Si |
|---|---|
| Molecular Weight | 327.33 |
| InChIKey | FVKQGXGGSCBBKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCOCCBr |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane? |
| A: Molecular formula of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane is C12H27BrO3Si. |
| Q: What is the Chinese name of 199484-67-8? |
| A: Chinese name of 199484-67-8 is 199484-67-8. |
| Q: What is the InChIKey of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane? |
| A: InChIKey of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane is FVKQGXGGSCBBKQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane? |
| A: CAS number of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane is 199484-67-8. |
| Q: What is the English name of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane? |
| A: The English name of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane is 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane. |
| Q: What is the SMILES notation of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane? |
| A: SMILES notation of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane is CC(C)(C)[Si](C)(C)OCCOCCOCCBr. |
| Q: What is the molecular weight of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane? |
| A: Molecular weight of 12-Bromo-2,2,3,3-tetramethyl-4,7,10-trioxa-3-siladodecane is 327.33. |