2,6-dimethyl-4-phenyl-heptan-4-ol structure
|
Common Name | 2,6-dimethyl-4-phenyl-heptan-4-ol | ||
|---|---|---|---|---|
| CAS Number | 19965-72-1 | Molecular Weight | 220.35000 | |
| Density | 0.93g/cm3 | Boiling Point | 263.5ºC at 760mmHg | |
| Molecular Formula | C15H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.7ºC | |
| Name | 2,6-dimethyl-4-phenylheptan-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 263.5ºC at 760mmHg |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35000 |
| Flash Point | 116.7ºC |
| Exact Mass | 220.18300 |
| PSA | 20.23000 |
| LogP | 3.96640 |
| Vapour Pressure | 0.00514mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | NSUDIPWPRVFYDC-UHFFFAOYSA-N |
| SMILES | CC(C)CC(O)(CC(C)C)c1ccccc1 |
|
~96%
2,6-dimethyl-4-... CAS#:19965-72-1 |
| Literature: Miyoshi, Norikazu; Matsuo, Tsuyoshi; Wada, Makoto European Journal of Organic Chemistry, 2005 , # 20 p. 4253 - 4255 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Diisobutyl-phenyl-carbinol |