ethyl N-(2,4,5-trifluorophenyl)carbamate
ethyl N-(2,4,5-trifluorophenyl)carbamate structure
|
Common Name | ethyl N-(2,4,5-trifluorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1997-88-2 | Molecular Weight | 219.16100 | |
| Density | 1.386g/cm3 | Boiling Point | 190.8ºC at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 69.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2,4,5-trifluorophenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 190.8ºC at 760 mmHg |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16100 |
| Flash Point | 69.2ºC |
| Exact Mass | 219.05100 |
| PSA | 38.33000 |
| LogP | 2.74530 |
| Vapour Pressure | 0.532mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | QDDGWVICYBTNKX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc(F)c(F)cc1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl N-(2,4,5-... CAS#:1997-88-2 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(2,4,5-trifluorophenyl)carbamate? |
| A: The English name of N-(2,4,5-trifluorophenyl)carbamate is N-(2,4,5-trifluorophenyl)carbamate. |
| Q: What is the boiling point of N-(2,4,5-trifluorophenyl)carbamate? |
| A: Boiling point of N-(2,4,5-trifluorophenyl)carbamate is 190.8ºC at 760 mmHg. |
| Q: What is the molecular weight of N-(2,4,5-trifluorophenyl)carbamate? |
| A: Molecular weight of N-(2,4,5-trifluorophenyl)carbamate is 219.16100. |
| Q: What is the polar surface area (PSA) of N-(2,4,5-trifluorophenyl)carbamate? |
| A: Polar surface area (PSA) of N-(2,4,5-trifluorophenyl)carbamate is 38.33000. |
| Q: What is the InChIKey of N-(2,4,5-trifluorophenyl)carbamate? |
| A: InChIKey of N-(2,4,5-trifluorophenyl)carbamate is QDDGWVICYBTNKX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(2,4,5-trifluorophenyl)carbamate? |
| A: SMILES notation of N-(2,4,5-trifluorophenyl)carbamate is CCOC(=O)Nc1cc(F)c(F)cc1F. |
| Q: What are the upstream materials of N-(2,4,5-trifluorophenyl)carbamate? |
| A: Related upstream materials(CAS) of N-(2,4,5-trifluorophenyl)carbamate: 367-34-0;541-41-3. |
| Q: What is the molecular formula of N-(2,4,5-trifluorophenyl)carbamate? |
| A: Molecular formula of N-(2,4,5-trifluorophenyl)carbamate is C9H8F3NO2. |
| Q: What is the LogP of N-(2,4,5-trifluorophenyl)carbamate? |
| A: LogP of N-(2,4,5-trifluorophenyl)carbamate is 2.74530. |
| Q: What is the Chinese name of 1997-88-2? |
| A: Chinese name of 1997-88-2 is 1997-88-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |