2-Nitro-1H-imidazole-1-acetic acid 2,3,5,6-tetrafluorophenyl ester structure
|
Common Name | 2-Nitro-1H-imidazole-1-acetic acid 2,3,5,6-tetrafluorophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 199734-70-8 | Molecular Weight | 319.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H5F4N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,5,6-tetrafluorophenyl) 2-(2-nitroimidazol-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H5F4N3O4 |
|---|---|
| Molecular Weight | 319.16900 |
| Exact Mass | 319.02200 |
| PSA | 89.94000 |
| LogP | 2.47650 |
| InChIKey | YCPHYOBSBOVNNZ-UHFFFAOYSA-N |
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])Oc1c(F)c(F)cc(F)c1F |
|
~55%
2-Nitro-1H-imid... CAS#:199734-70-8 |
| Literature: Wilson, Hanna Journal of Labelled Compounds and Radiopharmaceuticals, 2003 , vol. 46, # 6 p. 511 - 513 |
|
~%
2-Nitro-1H-imid... CAS#:199734-70-8 |
| Literature: Josse, Olivier; Labar, Daniel; Georges, Benoit; Gregoire, Vincent; Marchand-Brynaert, Jacqueline Bioorganic and Medicinal Chemistry, 2001 , vol. 9, # 3 p. 665 - 675 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3,5,6-tetrafluorophenyl (2-nitroimidazol-1-yl)acetate |
| 2,3,4,5-TETRAHYDRO-2-METHYL-2,5-BENZODIAZEPIN-1,4-DIONE |
| 2,3,5,6-tetrafluorophenyl 2-(2-nitroimidazol-1-yl)acetate |
| 1H-Imidazole-1-acetic acid,2-nitro-,2,3,5,6-tetrafluorophenyl ester |