1,1,2,2-tetrafluoro-1,2-bis(1,2,2-trifluoroethenoxy)ethane structure
|
Common Name | 1,1,2,2-tetrafluoro-1,2-bis(1,2,2-trifluoroethenoxy)ethane | ||
|---|---|---|---|---|
| CAS Number | 1998-53-4 | Molecular Weight | 294.04700 | |
| Density | 1.621g/cm3 | Boiling Point | 132.9ºC at 760 mmHg | |
| Molecular Formula | C6F10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 40ºC | |
| Name | 1,1,2,2-tetrafluoro-1,2-bis(1,2,2-trifluoroethenoxy)ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.621g/cm3 |
|---|---|
| Boiling Point | 132.9ºC at 760 mmHg |
| Molecular Formula | C6F10O2 |
| Molecular Weight | 294.04700 |
| Flash Point | 40ºC |
| Exact Mass | 293.97400 |
| PSA | 18.46000 |
| LogP | 4.27540 |
| Vapour Pressure | 10.7mmHg at 25°C |
| Index of Refraction | 1.304 |
| InChIKey | JZCZUPUWPJOIFG-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)OC(F)=C(F)F |
|
~%
1,1,2,2-tetrafl... CAS#:1998-53-4 |
| Literature: Takata, Kuniaki; Takesue, Masahiro; Iseki, Yuji; Sata, Toshikatu Journal of Fluorine Chemistry, 1995 , vol. 75, # 2 p. 163 - 168 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Perfluoro-3,6-dioxa-1,7-octadiene |
| EINECS 217-880-9 |