2-Chloro-6-(trifluoromethyl)-9H-purine structure
|
Common Name | 2-Chloro-6-(trifluoromethyl)-9H-purine | ||
|---|---|---|---|---|
| CAS Number | 1998-64-7 | Molecular Weight | 222.55500 | |
| Density | 1.94g/cm3 | Boiling Point | 204.3ºC at 760 mmHg | |
| Molecular Formula | C6H2ClF3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.4ºC | |
| Name | 2-chloro-6-(trifluoromethyl)-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 204.3ºC at 760 mmHg |
| Molecular Formula | C6H2ClF3N4 |
| Molecular Weight | 222.55500 |
| Flash Point | 77.4ºC |
| Exact Mass | 221.99200 |
| PSA | 54.46000 |
| LogP | 2.02510 |
| Vapour Pressure | 0.379mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | LTDVDSQMYOWJEV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nc(Cl)nc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chlor-2-trifluormethyl-purin |