2-chloro-1-fluoro-3,5-dinitrobenzene
Modify Date: 2026-09-19 20:44:37
2-chloro-1-fluoro-3,5-dinitrobenzene structure
|
Common Name | 2-chloro-1-fluoro-3,5-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1998-65-8 | Molecular Weight | 220.54200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2ClFN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-1-fluoro-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2ClFN2O4 |
|---|---|
| Molecular Weight | 220.54200 |
| Exact Mass | 219.96900 |
| PSA | 91.64000 |
| LogP | 3.34190 |
| InChIKey | KTMHJACCVZVTDG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)c(Cl)c([N+](=O)[O-])c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Fluor-1-chlor-4,6-dinitro-benzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: Molecular formula of 2-chloro-1-fluoro-3,5-dinitrobenzene is C6H2ClFN2O4. |
| Q: What English synonyms does 2-chloro-1-fluoro-3,5-dinitrobenzene have? |
| A: English synonyms of 2-chloro-1-fluoro-3,5-dinitrobenzene: 2-Fluor-1-chlor-4,6-dinitro-benzol. |
| Q: What is the SMILES notation of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: SMILES notation of 2-chloro-1-fluoro-3,5-dinitrobenzene is O=[N+]([O-])c1cc(F)c(Cl)c([N+](=O)[O-])c1. |
| Q: What is the LogP of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: LogP of 2-chloro-1-fluoro-3,5-dinitrobenzene is 3.34190. |
| Q: What is the Chinese name of 1998-65-8? |
| A: Chinese name of 1998-65-8 is 1998-65-8. |
| Q: What is the polar surface area (PSA) of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: Polar surface area (PSA) of 2-chloro-1-fluoro-3,5-dinitrobenzene is 91.64000. |
| Q: What is the molecular weight of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: Molecular weight of 2-chloro-1-fluoro-3,5-dinitrobenzene is 220.54200. |
| Q: What is the CAS number of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: CAS number of 2-chloro-1-fluoro-3,5-dinitrobenzene is 1998-65-8. |
| Q: What is the InChIKey of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: InChIKey of 2-chloro-1-fluoro-3,5-dinitrobenzene is KTMHJACCVZVTDG-UHFFFAOYSA-N. |
| Q: What is the English name of 2-chloro-1-fluoro-3,5-dinitrobenzene? |
| A: The English name of 2-chloro-1-fluoro-3,5-dinitrobenzene is 2-chloro-1-fluoro-3,5-dinitrobenzene. |