propan-2-yl N-[4-fluoro-3-(trifluoromethyl)phenyl]carbamate structure
|
Common Name | propan-2-yl N-[4-fluoro-3-(trifluoromethyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1998-81-8 | Molecular Weight | 265.20400 | |
| Density | 1.326g/cm3 | Boiling Point | 234.9ºC at 760 mmHg | |
| Molecular Formula | C11H11F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.9ºC | |
| Name | N-(4-Fluor-3-trifluormethyl-phenyl)-carbamidsaeure-ethylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 234.9ºC at 760 mmHg |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.20400 |
| Flash Point | 95.9ºC |
| Exact Mass | 265.07300 |
| PSA | 38.33000 |
| LogP | 3.87440 |
| Vapour Pressure | 0.0515mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | WKIHLKZZSUQTEM-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
|
~%
propan-2-yl N-[... CAS#:1998-81-8 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
|
~%
propan-2-yl N-[... CAS#:1998-81-8 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Acetamide,N-(4-ethynylphenyl)-2,2,2-trifluoro |
| N-<4-Fluor-3-trifluormethyl-phenyl>-carbamidsaeureisopropylester |
| N-(4-ethynyl-phenyl)-trifluoroacetamide |