[4-(hydroxymethyl)piperidin-1-yl]-phenylmethanone structure
|
Common Name | [4-(hydroxymethyl)piperidin-1-yl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 19980-00-8 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(hydroxymethyl)piperidin-1-yl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 40.54000 |
| LogP | 1.46900 |
| InChIKey | RLTIVBMLQJFUOB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)N1CCC(CO)CC1 |
|
~80%
[4-(hydroxymeth... CAS#:19980-00-8 |
| Literature: AXYS PHARMACEUTICALS, INC. Patent: WO2006/69096 A1, 2006 ; Location in patent: Page/Page column 96 ; WO 2006/069096 A1 |
|
~67%
[4-(hydroxymeth... CAS#:19980-00-8 |
| Literature: Barbe, Guillaume; Charette, Andre B. Journal of the American Chemical Society, 2008 , vol. 130, # 1 p. 18 - 19 |
|
~%
[4-(hydroxymeth... CAS#:19980-00-8 |
| Literature: Merck and Co., Inc. Patent: US6248755 B1, 2001 ; US 6248755 B1 |
|
~%
[4-(hydroxymeth... CAS#:19980-00-8 |
| Literature: Boehringer Mannheim GmbH Patent: US4243807 A1, 1981 ; |
|
~%
[4-(hydroxymeth... CAS#:19980-00-8 |
| Literature: Chang, Meng-Yang; Kung, Yung-Hua; Ma, Chih-Chong Tetrahedron Letters, 2007 , vol. 48, # 2 p. 199 - 202 |
|
~%
[4-(hydroxymeth... CAS#:19980-00-8 |
| Literature: Akula; Kabalka Journal of Labelled Compounds and Radiopharmaceuticals, 1999 , vol. 42, # SUPPL. 1 p. S782-S784 |
| (1-benzoylpiperid-4-yl)methanol |
| 4-Piperidinemethanol,1-benzoyl |
| (4-(hydroxymethyl)piperidin-1-yl)(phenyl)methanone |
| 1-benzoyl-4-hydroxymethyl-piperidine |
| (1-benzoyl-piperidin-4-yl)-methanol |
| 4-Hydroxymethyl-1-benzoyl Piperidine |
| N-benzoyl-4-hydroxymethylpiperidine |