CID 125462109
Modify Date: 2026-07-08 19:23:47
CID 125462109 structure
|
Common Name | CID 125462109 | ||
|---|---|---|---|---|
| CAS Number | 1998128-28-1 | Molecular Weight | 436.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 125462109 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H28N2O5 |
|---|---|
| Molecular Weight | 436.5 |
| InChIKey | YDGRWDYGDGXGBG-CBPXPLCBSA-N |
| SMILES | CC1(C)OC2C(NC(=O)c3ccccc3)C=C(CCO)C(NC(=O)c3ccccc3)C2O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1998128-28-1? |
| A: Chinese name of 1998128-28-1 is 1998128-28-1. |
| Q: What is the CAS number of CID 125462109? |
| A: CAS number of CID 125462109 is 1998128-28-1. |
| Q: What is the SMILES notation of CID 125462109? |
| A: SMILES notation of CID 125462109 is CC1(C)OC2C(NC(=O)c3ccccc3)C=C(CCO)C(NC(=O)c3ccccc3)C2O1. |
| Q: What is the InChIKey of CID 125462109? |
| A: InChIKey of CID 125462109 is YDGRWDYGDGXGBG-CBPXPLCBSA-N. |
| Q: What is the molecular formula of CID 125462109? |
| A: Molecular formula of CID 125462109 is C25H28N2O5. |
| Q: What is the molecular weight of CID 125462109? |
| A: Molecular weight of CID 125462109 is 436.5. |
| Q: What is the English name of CID 125462109? |
| A: The English name of CID 125462109 is CID 125462109. |