CID 125462056
Modify Date: 2025-09-10 12:04:01
CID 125462056 structure
|
Common Name | CID 125462056 | ||
|---|---|---|---|---|
| CAS Number | 1998128-34-9 | Molecular Weight | 228.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 125462056 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13ClN2O2 |
|---|---|
| Molecular Weight | 228.67 |
| InChIKey | MZQCIYWMIIDYGB-XFWSIPNHSA-N |
| SMILES | NC1c2cccc(Cl)c2C(N)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of CID 125462056? |
| A: The English name of CID 125462056 is CID 125462056. |
| Q: What is the SMILES notation of CID 125462056? |
| A: SMILES notation of CID 125462056 is NC1c2cccc(Cl)c2C(N)C(O)C1O. |
| Q: What is the CAS number of CID 125462056? |
| A: CAS number of CID 125462056 is 1998128-34-9. |
| Q: What is the molecular formula of CID 125462056? |
| A: Molecular formula of CID 125462056 is C10H13ClN2O2. |
| Q: What is the Chinese name of 1998128-34-9? |
| A: Chinese name of 1998128-34-9 is 1998128-34-9. |
| Q: What is the InChIKey of CID 125462056? |
| A: InChIKey of CID 125462056 is MZQCIYWMIIDYGB-XFWSIPNHSA-N. |
| Q: What is the molecular weight of CID 125462056? |
| A: Molecular weight of CID 125462056 is 228.67. |