(1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)
Modify Date: 2025-09-05 22:27:15
(1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) structure
|
Common Name | (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) | ||
|---|---|---|---|---|
| CAS Number | 1998128-36-1 | Molecular Weight | 302.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16BrN3O2 |
|---|---|
| Molecular Weight | 302.17 |
| InChIKey | OYVJHHDPOVHJMG-VPOLOUISSA-N |
| SMILES | CNc1ccc(Br)c2c1C(N)C(O)C(O)C2N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)? |
| A: Molecular formula of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) is C11H16BrN3O2. |
| Q: What is the InChIKey of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)? |
| A: InChIKey of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) is OYVJHHDPOVHJMG-VPOLOUISSA-N. |
| Q: What is the molecular weight of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)? |
| A: Molecular weight of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) is 302.17. |
| Q: What is the CAS number of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)? |
| A: CAS number of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) is 1998128-36-1. |
| Q: What is the SMILES notation of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)? |
| A: SMILES notation of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) is CNc1ccc(Br)c2c1C(N)C(O)C(O)C2N. |
| Q: What is the English name of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic)? |
| A: The English name of (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic) is (1S,2R,3S,4R)-1,4-diamino-5-bromo-8-(methylamino)-1,2,3,4-tetrahydronaphthalene-2,3-diol (racemic). |
| Q: What is the Chinese name of 1998128-36-1? |
| A: Chinese name of 1998128-36-1 is 1998128-36-1. |