2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate
Modify Date: 2026-08-09 01:01:10
2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate structure
|
Common Name | 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 1998215-87-4 | Molecular Weight | 349.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H32NO5P |
|---|---|
| Molecular Weight | 349.40 |
| InChIKey | WXVBEJZLDBMWSQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)NC(COP(=O)(O)O)C1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate? |
| A: InChIKey of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate is WXVBEJZLDBMWSQ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate? |
| A: The English name of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate is 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate. |
| Q: What is the CAS number of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate? |
| A: CAS number of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate is 1998215-87-4. |
| Q: What is the SMILES notation of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate? |
| A: SMILES notation of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate is CCCCCCCC(=O)NC(COP(=O)(O)O)C1CCCCC1. |
| Q: What is the molecular formula of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate? |
| A: Molecular formula of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate is C16H32NO5P. |
| Q: What is the molecular weight of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate? |
| A: Molecular weight of 2-Cyclohexyl-2-octanamidoethyl dihydrogen phosphate is 349.40. |
| Q: What is the Chinese name of 1998215-87-4? |
| A: Chinese name of 1998215-87-4 is 1998215-87-4. |