tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride
Modify Date: 2026-08-13 18:44:36
tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride structure
|
Common Name | tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1998216-27-5 | Molecular Weight | 223.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H18ClN3O2 |
|---|---|
| Molecular Weight | 223.70 |
| InChIKey | JJDZGMYQGLEKFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(NN)C1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride? |
| A: CAS number of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride is 1998216-27-5. |
| Q: What is the Chinese name of 1998216-27-5? |
| A: Chinese name of 1998216-27-5 is 1998216-27-5. |
| Q: What is the molecular formula of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride? |
| A: Molecular formula of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride is C8H18ClN3O2. |
| Q: What is the InChIKey of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride? |
| A: InChIKey of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride is JJDZGMYQGLEKFR-UHFFFAOYSA-N. |
| Q: What is the English name of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride? |
| A: The English name of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride is tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride. |
| Q: What is the molecular weight of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride? |
| A: Molecular weight of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride is 223.70. |
| Q: What is the SMILES notation of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride? |
| A: SMILES notation of tert-Butyl 3-hydrazinylazetidine-1-carboxylate hydrochloride is CC(C)(C)OC(=O)N1CC(NN)C1.Cl. |