Phosphorothioic acid, O,O-diethyl ester, O-ester with 2-chloro-4-hydroxy-N-methylbenzenesulfonamide structure
|
Common Name | Phosphorothioic acid, O,O-diethyl ester, O-ester with 2-chloro-4-hydroxy-N-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1999-86-6 | Molecular Weight | 373.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClNO5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphorothioic acid, O,O-diethyl ester, O-ester with 2-chloro-4-hydroxy-N-methylbenzenesulfonamide |
|---|
| Molecular Formula | C11H17ClNO5PS2 |
|---|---|
| Molecular Weight | 373.8 |
| InChIKey | UALHMKBFXBLUEQ-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1ccc(S(=O)(=O)NC)c(Cl)c1 |