benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate
Modify Date: 2026-07-12 18:38:41
![benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate Structure](https://www.chemsrc.com/extcaspic/110/1999392-75-4.png)
benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate structure
|
Common Name | benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1999392-75-4 | Molecular Weight | 305.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H13F2NO3 |
|---|---|
| Molecular Weight | 305.28 |
| InChIKey | SYLVTQCPSVLNSG-UHFFFAOYSA-N |
| SMILES | O=C(NCC(=O)c1c(F)cccc1F)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate? |
| A: CAS number of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate is 1999392-75-4. |
| Q: What is the English name of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate? |
| A: The English name of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate is benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate. |
| Q: What is the SMILES notation of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate? |
| A: SMILES notation of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate is O=C(NCC(=O)c1c(F)cccc1F)OCc1ccccc1. |
| Q: What is the molecular weight of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate? |
| A: Molecular weight of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate is 305.28. |
| Q: What is the Chinese name of 1999392-75-4? |
| A: Chinese name of 1999392-75-4 is 1999392-75-4. |
| Q: What is the InChIKey of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate? |
| A: InChIKey of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate is SYLVTQCPSVLNSG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate? |
| A: Molecular formula of benzyl N-[2-(2,6-difluorophenyl)-2-oxoethyl]carbamate is C16H13F2NO3. |