Acetamide,2-(2,4-dichlorophenoxy)-N-(2,2,2-trichloro-1-hydroxyethyl)- structure
|
Common Name | Acetamide,2-(2,4-dichlorophenoxy)-N-(2,2,2-trichloro-1-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2000-39-7 | Molecular Weight | 367.44000 | |
| Density | 1.633g/cm3 | Boiling Point | 507ºC at 760mmHg | |
| Molecular Formula | C10H8Cl5NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.4ºC | |
| Name | 2-(2,4-dichlorophenoxy)-N-(2,2,2-trichloro-1-hydroxyethyl)acetamide |
|---|
| Density | 1.633g/cm3 |
|---|---|
| Boiling Point | 507ºC at 760mmHg |
| Molecular Formula | C10H8Cl5NO3 |
| Molecular Weight | 367.44000 |
| Flash Point | 260.4ºC |
| Exact Mass | 364.89500 |
| PSA | 58.56000 |
| LogP | 3.56790 |
| Vapour Pressure | 4.23E-11mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | UEPNVEGEUUKYJR-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC(O)C(Cl)(Cl)Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |