1-(3-chloro-1-phenylpropoxy)-3-(trifluoromethyl)benzene structure
|
Common Name | 1-(3-chloro-1-phenylpropoxy)-3-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 200004-12-2 | Molecular Weight | 314.73000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-chloro-1-phenylpropoxy)-3-(trifluoromethyl)benzene |
|---|
| Molecular Formula | C16H14ClF3O |
|---|---|
| Molecular Weight | 314.73000 |
| Exact Mass | 314.06900 |
| PSA | 9.23000 |
| LogP | 5.45440 |
| InChIKey | IIVZQONMKSXJMD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(OC(CCCl)c2ccccc2)c1 |
|
~57%
1-(3-chloro-1-p... CAS#:200004-12-2 |
| Literature: Orjales, Aurelio; Mosquera, Ramon; Toledo, Antonio; Pumar, M. Carmen; Garcia, Neftali; Cortizo, Lourdes; Labeaga, Luis; Innerarity, Ana Journal of Medicinal Chemistry, 2003 , vol. 46, # 25 p. 5512 - 5532 |
|
~%
1-(3-chloro-1-p... CAS#:200004-12-2 |
| Literature: Orjales, Aurelio; Mosquera, Ramon; Toledo, Antonio; Pumar, M. Carmen; Garcia, Neftali; Cortizo, Lourdes; Labeaga, Luis; Innerarity, Ana Journal of Medicinal Chemistry, 2003 , vol. 46, # 25 p. 5512 - 5532 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |