methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate
Modify Date: 2026-09-27 14:33:08
![methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate Structure](https://www.chemsrc.com/extcaspic/481/2000441-75-6.png)
methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate structure
|
Common Name | methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 2000441-75-6 | Molecular Weight | 226.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N4O2 |
|---|---|
| Molecular Weight | 226.28 |
| InChIKey | DKALUCHTZWHMIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(NC(C)C)C(C)n1cncn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate? |
| A: Molecular formula of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate is C10H18N4O2. |
| Q: What is the English name of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate? |
| A: The English name of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate is methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate. |
| Q: What is the Chinese name of 2000441-75-6? |
| A: Chinese name of 2000441-75-6 is 2000441-75-6. |
| Q: What is the InChIKey of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate? |
| A: InChIKey of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate is DKALUCHTZWHMIK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate? |
| A: SMILES notation of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate is COC(=O)C(NC(C)C)C(C)n1cncn1. |
| Q: What is the CAS number of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate? |
| A: CAS number of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate is 2000441-75-6. |
| Q: What is the molecular weight of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate? |
| A: Molecular weight of methyl 2-[(propan-2-yl)amino]-3-(1H-1,2,4-triazol-1-yl)butanoate is 226.28. |