2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid
Modify Date: 2026-08-04 17:56:12
![2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid Structure](https://www.chemsrc.com/extcaspic/167/2000472-63-7.png)
2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid structure
|
Common Name | 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2000472-63-7 | Molecular Weight | 287.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16ClF2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16ClF2NO4 |
|---|---|
| Molecular Weight | 287.69 |
| InChIKey | NYMLWRXVDUDGKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(F)(F)Cl)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid? |
| A: Molecular weight of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid is 287.69. |
| Q: What is the SMILES notation of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid? |
| A: SMILES notation of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid is CC(C)(C)OC(=O)NC(CCC(F)(F)Cl)C(=O)O. |
| Q: What is the English name of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid? |
| A: The English name of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid is 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid. |
| Q: What is the molecular formula of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid? |
| A: Molecular formula of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid is C10H16ClF2NO4. |
| Q: What is the Chinese name of 2000472-63-7? |
| A: Chinese name of 2000472-63-7 is 2000472-63-7. |
| Q: What is the InChIKey of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid? |
| A: InChIKey of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid is NYMLWRXVDUDGKP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid? |
| A: CAS number of 2-{[(Tert-butoxy)carbonyl]amino}-5-chloro-5,5-difluoropentanoic acid is 2000472-63-7. |