1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro
Modify Date: 2025-09-29 20:44:23
![1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro Structure](https://www.chemsrc.com/extcaspic/357/200049-53-2.png)
1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro structure
|
Common Name | 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro | ||
|---|---|---|---|---|
| CAS Number | 200049-53-2 | Molecular Weight | 345.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H9F6NO |
|---|---|
| Molecular Weight | 345.24 |
| InChIKey | ARVHMIBNEIWRAV-UHFFFAOYSA-N |
| SMILES | O=C1NCc2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro? |
| A: CAS number of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro is 200049-53-2. |
| Q: What is the molecular formula of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro? |
| A: Molecular formula of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro is C16H9F6NO. |
| Q: What is the molecular weight of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro? |
| A: Molecular weight of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro is 345.24. |
| Q: What is the Chinese name of 200049-53-2? |
| A: Chinese name of 200049-53-2 is 200049-53-2. |
| Q: What is the English name of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro? |
| A: The English name of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro is 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro. |
| Q: What is the SMILES notation of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro? |
| A: SMILES notation of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro is O=C1NCc2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c21. |
| Q: What is the InChIKey of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro? |
| A: InChIKey of 1h-Isoindol-1-one,7-[3,5-bis(trifluoromethyl)phenyl]-2,3-dihydro is ARVHMIBNEIWRAV-UHFFFAOYSA-N. |