DCJTB
Modify Date: 2025-08-25 12:13:39
DCJTB structure
|
Common Name | DCJTB | ||
|---|---|---|---|---|
| CAS Number | 200052-70-6 | Molecular Weight | 453.618 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 561.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H35N3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 293.1±30.1 °C | |
| Name | 4-(Dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidin-4-yl-vinyl)-4H-pyran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.1±50.0 °C at 760 mmHg |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.618 |
| Flash Point | 293.1±30.1 °C |
| Exact Mass | 453.278015 |
| PSA | 60.05000 |
| LogP | 5.91 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | HXWWMGJBPGRWRS-CMDGGOBGSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C#N)C#N)C=C(C=Cc2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)O1 |
| RIDADR | NONH for all modes of transport |
|---|
|
Improved red dopants for organic electroluminescent devices. Chen CH,et al.
Macromol. Symp.
|
|
|
Red fluorescent organic light-emitting diodes using modified pyran-containing DCJTB derivatives. Lee KH, et al.
Bull. Korean Chem. Soc.
|
|
|
High-efficiency organic solar concentrators for photovoltaics. Currie MJ, et al.
Science
|
| 4-(Dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidin-4-yl-vinyl)-4H-pyran |
| MFCD08460403 |
| 2-tert-Butyl-4-(dicyanomethylene)-6-[2-(1,1,7,7-tetramethyljulolidin-9-yl)vinyl]-4H-pyran |
| 4-(dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidyl-9-enyl)-4H-pyran |
| Propanedinitrile, 2-[2-(1,1-dimethylethyl)-6-[(E)-2-(2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]- |
| {2-(2-Methyl-2-propanyl)-6-[(E)-2-(1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinolin-9-yl)vinyl]-4H-pyran-4-ylidene}malononitrile |
| 4-(dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidin-4-ylvinyl)-4H-pyran |
| DCJTB |