Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis structure
|
Common Name | Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis | ||
|---|---|---|---|---|
| CAS Number | 200064-34-2 | Molecular Weight | 249.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19N3O2 |
|---|---|
| Molecular Weight | 249.31 |
| InChIKey | RWPTVGMFKOCFCK-UHFFFAOYSA-N |
| SMILES | c1cc(N2CCOCC2)ncc1N1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis? |
| A: Molecular weight of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis is 249.31. |
| Q: What is the English name of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis? |
| A: The English name of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis is Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis. |
| Q: What is the Chinese name of 200064-34-2? |
| A: Chinese name of 200064-34-2 is 200064-34-2. |
| Q: What is the molecular formula of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis? |
| A: Molecular formula of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis is C13H19N3O2. |
| Q: What is the CAS number of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis? |
| A: CAS number of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis is 200064-34-2. |
| Q: What is the InChIKey of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis? |
| A: InChIKey of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis is RWPTVGMFKOCFCK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis? |
| A: SMILES notation of Morpholine, 4,4a(2)-(2,5-pyridinediyl)bis is c1cc(N2CCOCC2)ncc1N1CCOCC1. |