Hexulosonic acid 6-phosphate
Modify Date: 2025-11-19 10:44:48
Hexulosonic acid 6-phosphate structure
|
Common Name | Hexulosonic acid 6-phosphate | ||
|---|---|---|---|---|
| CAS Number | 20008-10-0 | Molecular Weight | 274.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hexulosonic acid 6-phosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H11O10P |
|---|---|
| Molecular Weight | 274.12 |
| InChIKey | JDXAGURJRSLJBI-JJYYJPOSSA-N |
| SMILES | O=C(OP(=O)(O)O)C(=O)C(O)C(O)C(O)CO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Hexulosonic acid 6-phosphate? |
| A: Molecular weight of Hexulosonic acid 6-phosphate is 274.12. |
| Q: What is the CAS number of Hexulosonic acid 6-phosphate? |
| A: CAS number of Hexulosonic acid 6-phosphate is 20008-10-0. |
| Q: What is the InChIKey of Hexulosonic acid 6-phosphate? |
| A: InChIKey of Hexulosonic acid 6-phosphate is JDXAGURJRSLJBI-JJYYJPOSSA-N. |
| Q: What is the English name of Hexulosonic acid 6-phosphate? |
| A: The English name of Hexulosonic acid 6-phosphate is Hexulosonic acid 6-phosphate. |
| Q: What is the SMILES notation of Hexulosonic acid 6-phosphate? |
| A: SMILES notation of Hexulosonic acid 6-phosphate is O=C(OP(=O)(O)O)C(=O)C(O)C(O)C(O)CO. |
| Q: What is the Chinese name of 20008-10-0? |
| A: Chinese name of 20008-10-0 is 20008-10-0. |
| Q: What is the molecular formula of Hexulosonic acid 6-phosphate? |
| A: Molecular formula of Hexulosonic acid 6-phosphate is C6H11O10P. |