2-bromo-1-(4-chlorophenyl)hexan-1-one structure
|
Common Name | 2-bromo-1-(4-chlorophenyl)hexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2001-08-3 | Molecular Weight | 289.59600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-1-(4-chlorophenyl)hexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14BrClO |
|---|---|
| Molecular Weight | 289.59600 |
| Exact Mass | 287.99200 |
| PSA | 17.07000 |
| LogP | 4.47640 |
| InChIKey | NWPUHTHUZNZKGP-UHFFFAOYSA-N |
| SMILES | CCCCC(Br)C(=O)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
2-bromo-1-(4-ch... CAS#:2001-08-3 |
| Literature: Imperial Chemical Industries PLC Patent: US4472415 A1, 1984 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-4'-chlorohexanophenone |