4-(4-methoxyphenyl)iminopentan-2-one structure
|
Common Name | 4-(4-methoxyphenyl)iminopentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 20010-38-2 | Molecular Weight | 205.25300 | |
| Density | 1.01g/cm3 | Boiling Point | 309ºC at 760 mmHg | |
| Molecular Formula | C12H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.3ºC | |
| Name | 4-(4-methoxyphenyl)iminopentan-2-one |
|---|
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 309ºC at 760 mmHg |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25300 |
| Flash Point | 131.3ºC |
| Exact Mass | 205.11000 |
| PSA | 38.66000 |
| LogP | 2.76670 |
| Vapour Pressure | 0.000657mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | KVXBWNALARBTOX-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C(C)CC(C)=O)cc1 |
| HS Code | 2925290090 |
|---|
|
~99%
4-(4-methoxyphe... CAS#:20010-38-2 |
| Literature: Vitanova, Daniela V.; Hampel, Frank; Hultzsch, Kai C. Journal of Organometallic Chemistry, 2011 , vol. 696, # 1 p. 321 - 330 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |