7,8-Dimethoxy-3-methyl-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepi ne structure
|
Common Name | 7,8-Dimethoxy-3-methyl-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepi ne | ||
|---|---|---|---|---|
| CAS Number | 20012-08-2 | Molecular Weight | 297.39100 | |
| Density | 1.072g/cm3 | Boiling Point | 416.8ºC at 760 mmHg | |
| Molecular Formula | C19H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.5ºC | |
| Name | 7,8-Dimethoxy-3-methyl-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepi ne |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760 mmHg |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.39100 |
| Flash Point | 137.5ºC |
| Exact Mass | 297.17300 |
| PSA | 21.70000 |
| LogP | 3.26150 |
| Vapour Pressure | 3.72E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | ICPHJSKVAZMKIV-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)CN(C)CC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-phenyl-2,3,4,5-tetrahydro-pyridine |
| 2,3,4,5-tetrahydro-6-phenylpyridine |
| Pyridine,2,3,4,5-tetrahydro-6-phenyl |
| 2-phenyl-3,4,5,6-tetrahydro-pyridine |
| 2,3,4,5-tetrahydro-7,8-dimethoxy-3-methyl-1-phenyl-1H-3-benzazepine |
| 1-phenyl-N-methyl-7,8-dimethoxy-1,2,4,5-tetrahydro-3H-benz<d>azepine |
| 6-Phenyl-2,3,4,5-tetrahydro-pyridin |
| 7,8-dimethoxy-3-methyl-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine |