(2-benzylcyclohexen-1-yl)oxy-trimethylsilane
Modify Date: 2025-08-25 18:37:15
(2-benzylcyclohexen-1-yl)oxy-trimethylsilane structure
|
Common Name | (2-benzylcyclohexen-1-yl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 200120-11-2 | Molecular Weight | 260.44700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-benzylcyclohexen-1-yl)oxy-trimethylsilane |
|---|
| Molecular Formula | C16H24OSi |
|---|---|
| Molecular Weight | 260.44700 |
| Exact Mass | 260.16000 |
| PSA | 9.23000 |
| LogP | 4.90870 |
| InChIKey | UQISMHLVBOIBID-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=C(Cc2ccccc2)CCCC1 |
|
~47%
(2-benzylcycloh... CAS#:200120-11-2 |
| Literature: Cheol, Hong Cheon; Yamamoto, Hisashi Journal of the American Chemical Society, 2008 , vol. 130, # 29 p. 9246 - 9247 |
|
~%
(2-benzylcycloh... CAS#:200120-11-2 |
| Literature: Mitsuhashi, Kaori; Ito, Rie; Arai, Takayoshi; Yanagisawa, Akira Organic Letters, 2006 , vol. 8, # 8 p. 1721 - 1724 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |